What is the 2-Pyridinecarbonitrile,6-amino-(9CI)?

2-Pyridinecarbonitrile,6-amino-(9CI) is , while it's Molecular Formula is C6H5 N3. Used in Pharmaceutical Synthesis: 2-Pyridinecarbonitrile,6-amino-(9CI) is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the attachment of different functional groups, making it a valuable component in the development of new drugs with specific therapeutic properties. Used in Agrochemical Production: In the agrochemical industry, 2-Pyridinecarbonitrile,6-amino-(9CI) is utilized as a starting material for the production of various agrochemicals. Its ability to form a range of derivatives with distinct functional groups contributes to the creation of effective compounds for crop protection and enhancement of agricultural yields. Used in Organic Synthesis: As a building block in organic synthesis, 2-Pyridinecarbonitrile,6-amino-(9CI) is employed for creating a diverse array of organic compounds. Its presence in the synthesis process allows for the development of new materials with unique properties and potential applications across various industries. Used in Biochemical Research: 2-Pyridinecarbonitrile,6-amino-(9CI) may have potential applications in biochemical research, where its structural features can be exploited to study interactions with biological molecules or to develop new probes for understanding complex biological processes.

What is the CAS number for 2-Pyridinecarbonitrile,6-amino-(9CI)?

The CAS number of 2-Pyridinecarbonitrile,6-amino-(9CI) is 370556-44-8.

What is 2-Pyridinecarbonitrile,6-amino-(9CI) (370556-44-8) used for?

2-Pyridinecarbonitrile,6-amino-(9CI) is a chemical compound with the molecular formula C6H5N3. It is a derivative of pyridine, featuring a cyano group and an amino group attached to the sixth carbon atom of the pyridine ring. 2-Pyridinecarbonitrile,6-amino-(9CI) serves as a versatile building block in organic synthesis, enabling the creation of a variety of derivatives with different functional groups attached to the pyridine ring. Its potential extends to the development of new materials and biochemical research, as well as its use in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds.InChI:InChI=1/C6H5N3/c7-4-5-2-1-3-6(8)9-5/h1-3H,(H2,8,9)

What is the 2-Pyridinecarbonitrile,6-amino-(9CI)?

2-Pyridinecarbonitrile,6-amino-(9CI) is , while it's Molecular Formula is C6H5 N3. Used in Pharmaceutical Synthesis: 2-Pyridinecarbonitrile,6-amino-(9CI) is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the attachment of different functional groups, making it a valuable component in the development of new drugs with specific therapeutic properties. Used in Agrochemical Production: In the agrochemical industry, 2-Pyridinecarbonitrile,6-amino-(9CI) is utilized as a starting material for the production of various agrochemicals. Its ability to form a range of derivatives with distinct functional groups contributes to the creation of effective compounds for crop protection and enhancement of agricultural yields. Used in Organic Synthesis: As a building block in organic synthesis, 2-Pyridinecarbonitrile,6-amino-(9CI) is employed for creating a diverse array of organic compounds. Its presence in the synthesis process allows for the development of new materials with unique properties and potential applications across various industries. Used in Biochemical Research: 2-Pyridinecarbonitrile,6-amino-(9CI) may have potential applications in biochemical research, where its structural features can be exploited to study interactions with biological molecules or to develop new probes for understanding complex biological processes.

What is the CAS number for 2-Pyridinecarbonitrile,6-amino-(9CI)?

The CAS number of 2-Pyridinecarbonitrile,6-amino-(9CI) is 370556-44-8.

What is 2-Pyridinecarbonitrile,6-amino-(9CI) (370556-44-8) used for?

2-Pyridinecarbonitrile,6-amino-(9CI) is a chemical compound with the molecular formula C6H5N3. It is a derivative of pyridine, featuring a cyano group and an amino group attached to the sixth carbon atom of the pyridine ring. 2-Pyridinecarbonitrile,6-amino-(9CI) serves as a versatile building block in organic synthesis, enabling the creation of a variety of derivatives with different functional groups attached to the pyridine ring. Its potential extends to the development of new materials and biochemical research, as well as its use in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds.InChI:InChI=1/C6H5N3/c7-4-5-2-1-3-6(8)9-5/h1-3H,(H2,8,9)

Your Location：Home > Products > Pharmaceutical > 370556-44-8

Product classification

370556-44-8

Product Name：2-amino-6-cyanopyridine
Molecular Formula：C6H5 N3
Purity：99%
Molecular Weight：119.12

Inquiry

Product Details

Purity:99%

Quality manufacturer supply 2-amino-6-cyanopyridine 370556-44-8 in stock with high standard

Molecular Formula:C6H5 N3
Molecular Weight:119.12
Vapor Pressure:0.000167mmHg at 25°C
Refractive Index:1.594
Boiling Point:330.4oC at 760 mmHg
PKA:1.60±0.24(Predicted)
Flash Point:153.6oC
PSA：62.70000
Density:1.23g/cm3
LogP:1.11668

2-Pyridinecarbonitrile,6-amino-(9CI)(Cas 370556-44-8) Usage

General Description

2-Pyridinecarbonitrile,6-amino-(9CI) is a chemical compound with the molecular formula C6H5N3. It is a derivative of pyridine and contains a cyano group and an amino group attached to the sixth carbon atom of the pyridine ring. 2-Pyridinecarbonitrile,6-amino-(9CI) is used in the synthesis of various pharmaceuticals, agrochemicals, and other organic compounds. It can also be used as a building block in organic synthesis to create a range of derivatives with different functional groups attached to the pyridine ring. Additionally, 2-Pyridinecarbonitrile,6-amino-(9CI) may have potential applications in the development of new materials or in biochemical research.

InChI:InChI=1/C6H5N3/c7-4-5-2-1-3-6(8)9-5/h1-3H,(H2,8,9)

Relevant Products

Methyl ortho hydroxy para aminobenzoate
CAS：4136-97-4
3-bromo-2- (bromomethyl) pyridine
CAS：754131-60-7
4-cyanopyridine-N-oxide
CAS：14906-59-3

Home

About us

Products

Pharmaceutical intermediates

Pharmaceutical

Pharmaceutical intermediate

Reagent

News

Contact Us