What is the 2-Pyrimidinecarbonitrile, 5-chloro- (9CI)?

2-Pyrimidinecarbonitrile, 5-chloro- (9CI) is , while it's Molecular Formula is C5H2ClN3. Used in Pharmaceutical Industry: 2-Pyrimidinecarbonitrile, 5-chloro(9CI) is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a building block in the development of new drugs with potential therapeutic applications. Used in Agrochemical Industry: In the agrochemical sector, 2-Pyrimidinecarbonitrile, 5-chloro(9CI) may be utilized as a precursor in the production of pesticides or other agrochemicals. Its reactivity and structural features can contribute to the creation of effective compounds for crop protection and management. Used in Chemical Research: 2-Pyrimidinecarbonitrile, 5-chloro(9CI) is also important for various analytical and synthetic purposes in chemical research. Its unique properties can be explored for the development of new chemical reactions, synthesis methods, or as a component in complex organic molecules.

What is the CAS number for 2-Pyrimidinecarbonitrile, 5-chloro- (9CI)?

The CAS number of 2-Pyrimidinecarbonitrile, 5-chloro- (9CI) is 38275-56-8.

What is 2-Pyrimidinecarbonitrile, 5-chloro- (9CI) (38275-56-8) used for?

2-Pyrimidinecarbonitrile, 5-chloro(9CI) is a pyrimidine derivative, an aromatic heterocyclic organic compound with a chlorine atom and a cyano group in its structure. As a member of the pyrimidine family, it shares similarities with pyridine but with a nitrogen atom replacing one of the carbon atoms. The presence of the chlorine and cyano groups suggests potential reactivity and diverse applications in various fields.InChI:InChI=1/C5H2ClN3/c6-4-2-8-5(1-7)9-3-4/h2-3H

What is the 2-Pyrimidinecarbonitrile, 5-chloro- (9CI)?

2-Pyrimidinecarbonitrile, 5-chloro- (9CI) is , while it's Molecular Formula is C5H2ClN3. Used in Pharmaceutical Industry: 2-Pyrimidinecarbonitrile, 5-chloro(9CI) is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a building block in the development of new drugs with potential therapeutic applications. Used in Agrochemical Industry: In the agrochemical sector, 2-Pyrimidinecarbonitrile, 5-chloro(9CI) may be utilized as a precursor in the production of pesticides or other agrochemicals. Its reactivity and structural features can contribute to the creation of effective compounds for crop protection and management. Used in Chemical Research: 2-Pyrimidinecarbonitrile, 5-chloro(9CI) is also important for various analytical and synthetic purposes in chemical research. Its unique properties can be explored for the development of new chemical reactions, synthesis methods, or as a component in complex organic molecules.

What is the CAS number for 2-Pyrimidinecarbonitrile, 5-chloro- (9CI)?

The CAS number of 2-Pyrimidinecarbonitrile, 5-chloro- (9CI) is 38275-56-8.

What is 2-Pyrimidinecarbonitrile, 5-chloro- (9CI) (38275-56-8) used for?

2-Pyrimidinecarbonitrile, 5-chloro(9CI) is a pyrimidine derivative, an aromatic heterocyclic organic compound with a chlorine atom and a cyano group in its structure. As a member of the pyrimidine family, it shares similarities with pyridine but with a nitrogen atom replacing one of the carbon atoms. The presence of the chlorine and cyano groups suggests potential reactivity and diverse applications in various fields.InChI:InChI=1/C5H2ClN3/c6-4-2-8-5(1-7)9-3-4/h2-3H

Your Location：Home > Products > Pharmaceutical > 38275-56-8

Product classification

38275-56-8

Product Name：2-Cyano-5-chloropyrimidine
Molecular Formula：C₅H₂ClN₃
Purity：99%
Molecular Weight：139.54

Inquiry

Product Details

pd_meltingpoint:78 °C

Purity:99%

Chinese Factory Supply Wholesale 2-Cyano-5-chloropyrimidine 38275-56-8 with Cheap Price

Molecular Formula:C5H2ClN3
Molecular Weight:139.54
Vapor Pressure:0.00189mmHg at 25°C
Melting Point:78 °C
Refractive Index:1.568
Boiling Point:292 °C at 760 mmHg
PKA:-4.65±0.22(Predicted)
Flash Point:130.4 °C
PSA：49.57000
Density:1.44 g/cm³
LogP:1.00168

2-Pyrimidinecarbonitrile, 5-chloro- (9CI)(Cas 38275-56-8) Usage

General Description

2-Pyrimidinecarbonitrile, 5-chloro- (9CI) is a chemical compound classified under the pyrimidine category. Pyrimidines are aromatic heterocyclic organic compounds similar to pyridine, with one carbon atom replaced by a nitrogen atom. 2-Pyrimidinecarbonitrile, 5-chloro- possess a chlorine atom along with a cyano group in its structure suggesting potential reactivity. Although there is limited specific information available regarding its physical properties or uses, as a derivative of pyrimidine, it may have potential use in a variety of applications including pharmaceuticals, agrochemicals, and other chemical research. 2-Pyrimidinecarbonitrile, 5-chloro- (9CI) also might be important for various analytical and synthetic purposes. However, health and environmental impacts should be adequately evaluated before use.

InChI:InChI=1/C5H2ClN3/c6-4-2-8-5(1-7)9-3-4/h2-3H